C16H22N2O2S2 — CID 27666413
[2-(2-methoxyanilino)-2-oxoethyl] 4-methylpiperidine-1-carbodithioate (PubChem CID 27666413) has the molecular formula C16H22N2O2S2 and a molecular weight of 338.50 g/mol. Its IUPAC name is [2-(2-methoxyanilino)-2-oxoethyl] 4-methylpiperidine-1-carbodithioate.
| Compound Name | [2-(2-methoxyanilino)-2-oxoethyl] 4-methylpiperidine-1-carbodithioate |
|---|---|
| PubChem CID | 27666413 |
| Molecular Formula | C16H22N2O2S2 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | [2-(2-methoxyanilino)-2-oxoethyl] 4-methylpiperidine-1-carbodithioate |
| SMILES | COc1ccccc1NC(=O)CSC(=S)N1CCC(C)CC1 |
| InChI | InChI=1S/C16H22N2O2S2/c1-12-7-9-18(10-8-12)16(21)22-11-15(19)17-13-5-3-4-6-14(13)20-2/h3-6,12H,7-11H2,1-2H3,(H,17,19) |
| InChIKey | AXOZOLSBBBPDTL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|