C17H24N2OS2 — CID 4665305
[2-(2,5-dimethylanilino)-2-oxoethyl] 4-methylpiperidine-1-carbodithioate (PubChem CID 4665305) has the molecular formula C17H24N2OS2 and a molecular weight of 336.53 g/mol. Its IUPAC name is [2-(2,5-dimethylanilino)-2-oxoethyl] 4-methylpiperidine-1-carbodithioate.
| Compound Name | [2-(2,5-dimethylanilino)-2-oxoethyl] 4-methylpiperidine-1-carbodithioate |
|---|---|
| PubChem CID | 4665305 |
| Molecular Formula | C17H24N2OS2 |
| Molecular Weight | 336.53 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | [2-(2,5-dimethylanilino)-2-oxoethyl] 4-methylpiperidine-1-carbodithioate |
| SMILES | Cc1ccc(C)c(NC(=O)CSC(=S)N2CCC(C)CC2)c1 |
| InChI | InChI=1S/C17H24N2OS2/c1-12-6-8-19(9-7-12)17(21)22-11-16(20)18-15-10-13(2)4-5-14(15)3/h4-5,10,12H,6-9,11H2,1-3H3,(H,18,20) |
| InChIKey | GRKYNDXDMBMFRE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.53 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|