C20H30N2O2S2 — CID 9192374
[2-(5-tert-butyl-2-methoxyanilino)-2-oxoethyl] 4-methylpiperidine-1-carbodithioate (PubChem CID 9192374) has the molecular formula C20H30N2O2S2 and a molecular weight of 394.61 g/mol. Its IUPAC name is [2-(5-tert-butyl-2-methoxyanilino)-2-oxoethyl] 4-methylpiperidine-1-carbodithioate.
| Compound Name | [2-(5-tert-butyl-2-methoxyanilino)-2-oxoethyl] 4-methylpiperidine-1-carbodithioate |
|---|---|
| PubChem CID | 9192374 |
| Molecular Formula | C20H30N2O2S2 |
| Molecular Weight | 394.61 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | [2-(5-tert-butyl-2-methoxyanilino)-2-oxoethyl] 4-methylpiperidine-1-carbodithioate |
| SMILES | COc1ccc(C(C)(C)C)cc1NC(=O)CSC(=S)N1CCC(C)CC1 |
| InChI | InChI=1S/C20H30N2O2S2/c1-14-8-10-22(11-9-14)19(25)26-13-18(23)21-16-12-15(20(2,3)4)6-7-17(16)24-5/h6-7,12,14H,8-11,13H2,1-5H3,(H,21,23) |
| InChIKey | NGRLIMYXKUIHSQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.61 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|