C20H29N3O2S2 — CID 9319064
[2-[[2-(2,5-dimethylanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] (3R)-3-methylpiperidine-1-carbodithioate (PubChem CID 9319064) has the molecular formula C20H29N3O2S2 and a molecular weight of 407.61 g/mol. Its IUPAC name is [2-[[2-(2,5-dimethylanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] (3R)-3-methylpiperidine-1-carbodithioate.
| Compound Name | [2-[[2-(2,5-dimethylanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] (3R)-3-methylpiperidine-1-carbodithioate |
|---|---|
| PubChem CID | 9319064 |
| Molecular Formula | C20H29N3O2S2 |
| Molecular Weight | 407.61 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | [2-[[2-(2,5-dimethylanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] (3R)-3-methylpiperidine-1-carbodithioate |
| SMILES | Cc1ccc(C)c(NC(=O)CN(C)C(=O)CSC(=S)N2CCC[C@@H](C)C2)c1 |
| InChI | InChI=1S/C20H29N3O2S2/c1-14-7-8-16(3)17(10-14)21-18(24)12-22(4)19(25)13-27-20(26)23-9-5-6-15(2)11-23/h7-8,10,15H,5-6,9,11-13H2,1-4H3,(H,21,24)/t15-/m1/s1 |
| InChIKey | AIJXXRIBQMQLAE-OAHLLOKOSA-N |
| XLogP | 3.45 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.61 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|