C19H27N3O2S2 — CID 8967304
[2-[methyl-[[4-(methylcarbamoyl)phenyl]methyl]amino]-2-oxoethyl] (3R)-3-methylpiperidine-1-carbodithioate (PubChem CID 8967304) has the molecular formula C19H27N3O2S2 and a molecular weight of 393.58 g/mol. Its IUPAC name is [2-[methyl-[[4-(methylcarbamoyl)phenyl]methyl]amino]-2-oxoethyl] (3R)-3-methylpiperidine-1-carbodithioate.
| Compound Name | [2-[methyl-[[4-(methylcarbamoyl)phenyl]methyl]amino]-2-oxoethyl] (3R)-3-methylpiperidine-1-carbodithioate |
|---|---|
| PubChem CID | 8967304 |
| Molecular Formula | C19H27N3O2S2 |
| Molecular Weight | 393.58 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | [2-[methyl-[[4-(methylcarbamoyl)phenyl]methyl]amino]-2-oxoethyl] (3R)-3-methylpiperidine-1-carbodithioate |
| SMILES | CNC(=O)c1ccc(CN(C)C(=O)CSC(=S)N2CCC[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C19H27N3O2S2/c1-14-5-4-10-22(11-14)19(25)26-13-17(23)21(3)12-15-6-8-16(9-7-15)18(24)20-2/h6-9,14H,4-5,10-13H2,1-3H3,(H,20,24)/t14-/m1/s1 |
| InChIKey | UKTPSWOQPPVGBD-CQSZACIVSA-N |
| XLogP | 2.75 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.58 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|