C16H20ClN3O2S2 — CID 7606885
[2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate (PubChem CID 7606885) has the molecular formula C16H20ClN3O2S2 and a molecular weight of 385.94 g/mol. Its IUPAC name is [2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate.
| Compound Name | [2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 7606885 |
| Molecular Formula | C16H20ClN3O2S2 |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | [2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate |
| SMILES | CN(CC(=O)Nc1ccccc1Cl)C(=O)CSC(=S)N1CCCC1 |
| InChI | InChI=1S/C16H20ClN3O2S2/c1-19(10-14(21)18-13-7-3-2-6-12(13)17)15(22)11-24-16(23)20-8-4-5-9-20/h2-3,6-7H,4-5,8-11H2,1H3,(H,18,21) |
| InChIKey | KYGNCZVQBRVSKB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|