C19H20ClN3O4 — CID 4787114
N-[2-(2-chloroanilino)-2-oxoethyl]-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-methylacetamide (PubChem CID 4787114) has the molecular formula C19H20ClN3O4 and a molecular weight of 389.84 g/mol. Its IUPAC name is N-[2-(2-chloroanilino)-2-oxoethyl]-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-methylacetamide.
| Compound Name | N-[2-(2-chloroanilino)-2-oxoethyl]-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 4787114 |
| Molecular Formula | C19H20ClN3O4 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | N-[2-(2-chloroanilino)-2-oxoethyl]-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-methylacetamide |
| SMILES | CN(CC(=O)Nc1ccccc1Cl)C(=O)CN1C(=O)C2CC=CCC2C1=O |
| InChI | InChI=1S/C19H20ClN3O4/c1-22(10-16(24)21-15-9-5-4-8-14(15)20)17(25)11-23-18(26)12-6-2-3-7-13(12)19(23)27/h2-5,8-9,12-13H,6-7,10-11H2,1H3,(H,21,24) |
| InChIKey | WBESGVINEXUGLD-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|