C21H25ClN4O3 — CID 51608553
2-[4-[[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]methyl]piperazin-1-yl]-N-(2-chlorophenyl)acetamide (PubChem CID 51608553) has the molecular formula C21H25ClN4O3 and a molecular weight of 416.91 g/mol. Its IUPAC name is 2-[4-[[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]methyl]piperazin-1-yl]-N-(2-chlorophenyl)acetamide.
| Compound Name | 2-[4-[[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]methyl]piperazin-1-yl]-N-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 51608553 |
| Molecular Formula | C21H25ClN4O3 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 2-[4-[[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]methyl]piperazin-1-yl]-N-(2-chlorophenyl)acetamide |
| SMILES | O=C(CN1CCN(CN2C(=O)[C@H]3CC=CC[C@H]3C2=O)CC1)Nc1ccccc1Cl |
| InChI | InChI=1S/C21H25ClN4O3/c22-17-7-3-4-8-18(17)23-19(27)13-24-9-11-25(12-10-24)14-26-20(28)15-5-1-2-6-16(15)21(26)29/h1-4,7-8,15-16H,5-6,9-14H2,(H,23,27)/t15-,16+ |
| InChIKey | RORWWZNIZJZBRR-IYBDPMFKSA-N |
| XLogP | 1.80 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|