C22H27ClN4O2 — CID 26539561
N-[2-(2-chloroanilino)-2-oxoethyl]-N-methyl-2-(2-piperidin-1-ylanilino)acetamide (PubChem CID 26539561) has the molecular formula C22H27ClN4O2 and a molecular weight of 414.94 g/mol. Its IUPAC name is N-[2-(2-chloroanilino)-2-oxoethyl]-N-methyl-2-(2-piperidin-1-ylanilino)acetamide.
| Compound Name | N-[2-(2-chloroanilino)-2-oxoethyl]-N-methyl-2-(2-piperidin-1-ylanilino)acetamide |
|---|---|
| PubChem CID | 26539561 |
| Molecular Formula | C22H27ClN4O2 |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N-[2-(2-chloroanilino)-2-oxoethyl]-N-methyl-2-(2-piperidin-1-ylanilino)acetamide |
| SMILES | CN(CC(=O)Nc1ccccc1Cl)C(=O)CNc1ccccc1N1CCCCC1 |
| InChI | InChI=1S/C22H27ClN4O2/c1-26(16-21(28)25-18-10-4-3-9-17(18)23)22(29)15-24-19-11-5-6-12-20(19)27-13-7-2-8-14-27/h3-6,9-12,24H,2,7-8,13-16H2,1H3,(H,25,28) |
| InChIKey | PTEPGOWIJRGPFE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |