C21H30N2O3 — CID 109146305
N-(2-methoxyphenyl)-4-(4-methylpiperidine-1-carbonyl)cyclohexane-1-carboxamide (PubChem CID 109146305) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-4-(4-methylpiperidine-1-carbonyl)cyclohexane-1-carboxamide.
| Compound Name | N-(2-methoxyphenyl)-4-(4-methylpiperidine-1-carbonyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 109146305 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | N-(2-methoxyphenyl)-4-(4-methylpiperidine-1-carbonyl)cyclohexane-1-carboxamide |
| SMILES | COc1ccccc1NC(=O)C1CCC(C(=O)N2CCC(C)CC2)CC1 |
| InChI | InChI=1S/C21H30N2O3/c1-15-11-13-23(14-12-15)21(25)17-9-7-16(8-10-17)20(24)22-18-5-3-4-6-19(18)26-2/h3-6,15-17H,7-14H2,1-2H3,(H,22,24) |
| InChIKey | NULHKEAVBONWEX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |