C21H23ClN2O3 — CID 109150938
4-N-(2-chlorophenyl)-1-N-(2-methoxyphenyl)cyclohexane-1,4-dicarboxamide (PubChem CID 109150938) has the molecular formula C21H23ClN2O3 and a molecular weight of 386.88 g/mol. Its IUPAC name is 4-N-(2-chlorophenyl)-1-N-(2-methoxyphenyl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-(2-chlorophenyl)-1-N-(2-methoxyphenyl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109150938 |
| Molecular Formula | C21H23ClN2O3 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 4-N-(2-chlorophenyl)-1-N-(2-methoxyphenyl)cyclohexane-1,4-dicarboxamide |
| SMILES | COc1ccccc1NC(=O)C1CCC(C(=O)Nc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C21H23ClN2O3/c1-27-19-9-5-4-8-18(19)24-21(26)15-12-10-14(11-13-15)20(25)23-17-7-3-2-6-16(17)22/h2-9,14-15H,10-13H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | LYRWSBVVHCLFTH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |