C14H19BrN3OS2+ — CID 9423448
[2-(2-bromoanilino)-2-oxoethyl] 4-methylpiperazin-4-ium-1-carbodithioate (PubChem CID 9423448) has the molecular formula C14H19BrN3OS2+ and a molecular weight of 389.36 g/mol. Its IUPAC name is [2-(2-bromoanilino)-2-oxoethyl] 4-methylpiperazin-4-ium-1-carbodithioate.
| Compound Name | [2-(2-bromoanilino)-2-oxoethyl] 4-methylpiperazin-4-ium-1-carbodithioate |
|---|---|
| PubChem CID | 9423448 |
| Molecular Formula | C14H19BrN3OS2+ |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | [2-(2-bromoanilino)-2-oxoethyl] 4-methylpiperazin-4-ium-1-carbodithioate |
| SMILES | C[NH+]1CCN(C(=S)SCC(=O)Nc2ccccc2Br)CC1 |
| InChI | InChI=1S/C14H18BrN3OS2/c1-17-6-8-18(9-7-17)14(20)21-10-13(19)16-12-5-3-2-4-11(12)15/h2-5H,6-10H2,1H3,(H,16,19)/p+1 |
| InChIKey | GWFYRLZIFAASON-UHFFFAOYSA-O |
| XLogP | 1.24 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|