C19H20N2OS3 — CID 7607354
[2-oxo-2-(2-phenylsulfanylanilino)ethyl] pyrrolidine-1-carbodithioate (PubChem CID 7607354) has the molecular formula C19H20N2OS3 and a molecular weight of 388.58 g/mol. Its IUPAC name is [2-oxo-2-(2-phenylsulfanylanilino)ethyl] pyrrolidine-1-carbodithioate.
| Compound Name | [2-oxo-2-(2-phenylsulfanylanilino)ethyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 7607354 |
| Molecular Formula | C19H20N2OS3 |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | [2-oxo-2-(2-phenylsulfanylanilino)ethyl] pyrrolidine-1-carbodithioate |
| SMILES | O=C(CSC(=S)N1CCCC1)Nc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C19H20N2OS3/c22-18(14-24-19(23)21-12-6-7-13-21)20-16-10-4-5-11-17(16)25-15-8-2-1-3-9-15/h1-5,8-11H,6-7,12-14H2,(H,20,22) |
| InChIKey | CWODARCRSJLZBD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|