C17H18N2OS2 — CID 7607162
[2-(naphthalen-2-ylamino)-2-oxoethyl] pyrrolidine-1-carbodithioate (PubChem CID 7607162) has the molecular formula C17H18N2OS2 and a molecular weight of 330.48 g/mol. Its IUPAC name is [2-(naphthalen-2-ylamino)-2-oxoethyl] pyrrolidine-1-carbodithioate.
| Compound Name | [2-(naphthalen-2-ylamino)-2-oxoethyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 7607162 |
| Molecular Formula | C17H18N2OS2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | [2-(naphthalen-2-ylamino)-2-oxoethyl] pyrrolidine-1-carbodithioate |
| SMILES | O=C(CSC(=S)N1CCCC1)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H18N2OS2/c20-16(12-22-17(21)19-9-3-4-10-19)18-15-8-7-13-5-1-2-6-14(13)11-15/h1-2,5-8,11H,3-4,9-10,12H2,(H,18,20) |
| InChIKey | IFCDBRTYVZWXPI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|