C27H26N2O2S2 — CID 4994531
N-naphthalen-2-yl-2-[3-[2-(naphthalen-2-ylamino)-2-oxoethyl]sulfanylpropylsulfanyl]acetamide (PubChem CID 4994531) has the molecular formula C27H26N2O2S2 and a molecular weight of 474.65 g/mol. Its IUPAC name is N-naphthalen-2-yl-2-[3-[2-(naphthalen-2-ylamino)-2-oxoethyl]sulfanylpropylsulfanyl]acetamide.
| Compound Name | N-naphthalen-2-yl-2-[3-[2-(naphthalen-2-ylamino)-2-oxoethyl]sulfanylpropylsulfanyl]acetamide |
|---|---|
| PubChem CID | 4994531 |
| Molecular Formula | C27H26N2O2S2 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | N-naphthalen-2-yl-2-[3-[2-(naphthalen-2-ylamino)-2-oxoethyl]sulfanylpropylsulfanyl]acetamide |
| SMILES | O=C(CSCCCSCC(=O)Nc1ccc2ccccc2c1)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H26N2O2S2/c30-26(28-24-12-10-20-6-1-3-8-22(20)16-24)18-32-14-5-15-33-19-27(31)29-25-13-11-21-7-2-4-9-23(21)17-25/h1-4,6-13,16-17H,5,14-15,18-19H2,(H,28,30)(H,29,31) |
| InChIKey | NVNIBURGJJUXHU-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|