C34H38N4O2S2 — CID 126713457
2-[6-[2-(4-anilinoanilino)-2-oxoethyl]sulfanylhexylsulfanyl]-N-(4-anilinophenyl)acetamide (PubChem CID 126713457) has the molecular formula C34H38N4O2S2 and a molecular weight of 598.84 g/mol. Its IUPAC name is 2-[6-[2-(4-anilinoanilino)-2-oxoethyl]sulfanylhexylsulfanyl]-N-(4-anilinophenyl)acetamide.
| Compound Name | 2-[6-[2-(4-anilinoanilino)-2-oxoethyl]sulfanylhexylsulfanyl]-N-(4-anilinophenyl)acetamide |
|---|---|
| PubChem CID | 126713457 |
| Molecular Formula | C34H38N4O2S2 |
| Molecular Weight | 598.84 g/mol |
| Exact Mass | 598.24 |
| IUPAC Name | 2-[6-[2-(4-anilinoanilino)-2-oxoethyl]sulfanylhexylsulfanyl]-N-(4-anilinophenyl)acetamide |
| SMILES | O=C(CSCCCCCCSCC(=O)Nc1ccc(Nc2ccccc2)cc1)Nc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C34H38N4O2S2/c39-33(37-31-19-15-29(16-20-31)35-27-11-5-3-6-12-27)25-41-23-9-1-2-10-24-42-26-34(40)38-32-21-17-30(18-22-32)36-28-13-7-4-8-14-28/h3-8,11-22,35-36H,1-2,9-10,23-26H2,(H,37,39)(H,38,40) |
| InChIKey | QOAWVTYNQDYBPI-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.84 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|