C34H36N2O2S2 — CID 159173990
2-[4-[3-(4-anilinophenyl)-2-oxopropyl]sulfanylbutylsulfanyl]-N-(4-benzylphenyl)acetamide (PubChem CID 159173990) has the molecular formula C34H36N2O2S2 and a molecular weight of 568.81 g/mol. Its IUPAC name is 2-[4-[3-(4-anilinophenyl)-2-oxopropyl]sulfanylbutylsulfanyl]-N-(4-benzylphenyl)acetamide.
| Compound Name | 2-[4-[3-(4-anilinophenyl)-2-oxopropyl]sulfanylbutylsulfanyl]-N-(4-benzylphenyl)acetamide |
|---|---|
| PubChem CID | 159173990 |
| Molecular Formula | C34H36N2O2S2 |
| Molecular Weight | 568.81 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | 2-[4-[3-(4-anilinophenyl)-2-oxopropyl]sulfanylbutylsulfanyl]-N-(4-benzylphenyl)acetamide |
| SMILES | O=C(CSCCCCSCC(=O)Nc1ccc(Cc2ccccc2)cc1)Cc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C34H36N2O2S2/c37-33(24-29-15-17-31(18-16-29)35-30-11-5-2-6-12-30)25-39-21-7-8-22-40-26-34(38)36-32-19-13-28(14-20-32)23-27-9-3-1-4-10-27/h1-6,9-20,35H,7-8,21-26H2,(H,36,38) |
| InChIKey | KMAVPNDZSUPJJC-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.81 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|