C15H16N2OS2 — CID 2403487
[2-(naphthalen-2-ylamino)-2-oxoethyl] N,N-dimethylcarbamodithioate (PubChem CID 2403487) has the molecular formula C15H16N2OS2 and a molecular weight of 304.44 g/mol. Its IUPAC name is [2-(naphthalen-2-ylamino)-2-oxoethyl] N,N-dimethylcarbamodithioate.
| Compound Name | [2-(naphthalen-2-ylamino)-2-oxoethyl] N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 2403487 |
| Molecular Formula | C15H16N2OS2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | [2-(naphthalen-2-ylamino)-2-oxoethyl] N,N-dimethylcarbamodithioate |
| SMILES | CN(C)C(=S)SCC(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H16N2OS2/c1-17(2)15(19)20-10-14(18)16-13-8-7-11-5-3-4-6-12(11)9-13/h3-9H,10H2,1-2H3,(H,16,18) |
| InChIKey | MYQQIRZNQQVVBT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|