C12H12F2N2O3S2 — CID 3615855
[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] N,N-dimethylcarbamodithioate (PubChem CID 3615855) has the molecular formula C12H12F2N2O3S2 and a molecular weight of 334.37 g/mol. Its IUPAC name is [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] N,N-dimethylcarbamodithioate.
| Compound Name | [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 3615855 |
| Molecular Formula | C12H12F2N2O3S2 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] N,N-dimethylcarbamodithioate |
| SMILES | CN(C)C(=S)SCC(=O)Nc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C12H12F2N2O3S2/c1-16(2)11(20)21-6-10(17)15-7-3-4-8-9(5-7)19-12(13,14)18-8/h3-5H,6H2,1-2H3,(H,15,17) |
| InChIKey | LONNZCXXIASJCL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|