C15H19F2N2O3+ — CID 2461345
2-(azepan-1-ium-1-yl)-N-(2,2-difluoro-1,3-benzodioxol-5-yl)acetamide (PubChem CID 2461345) has the molecular formula C15H19F2N2O3+ and a molecular weight of 313.32 g/mol. Its IUPAC name is 2-(azepan-1-ium-1-yl)-N-(2,2-difluoro-1,3-benzodioxol-5-yl)acetamide.
| Compound Name | 2-(azepan-1-ium-1-yl)-N-(2,2-difluoro-1,3-benzodioxol-5-yl)acetamide |
|---|---|
| PubChem CID | 2461345 |
| Molecular Formula | C15H19F2N2O3+ |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 2-(azepan-1-ium-1-yl)-N-(2,2-difluoro-1,3-benzodioxol-5-yl)acetamide |
| SMILES | O=C(C[NH+]1CCCCCC1)Nc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C15H18F2N2O3/c16-15(17)21-12-6-5-11(9-13(12)22-15)18-14(20)10-19-7-3-1-2-4-8-19/h5-6,9H,1-4,7-8,10H2,(H,18,20)/p+1 |
| InChIKey | XBOCOTWOVORPII-UHFFFAOYSA-O |
| XLogP | 1.41 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |