C19H19F2N4O7S+ — CID 2407036
N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-ium-1-yl]acetamide (PubChem CID 2407036) has the molecular formula C19H19F2N4O7S+ and a molecular weight of 485.45 g/mol. Its IUPAC name is N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 2407036 |
| Molecular Formula | C19H19F2N4O7S+ |
| Molecular Weight | 485.45 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-ium-1-yl]acetamide |
| SMILES | O=C(C[NH+]1CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])CC1)Nc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C19H18F2N4O7S/c20-19(21)31-15-6-5-13(11-16(15)32-19)22-18(26)12-23-7-9-24(10-8-23)33(29,30)17-4-2-1-3-14(17)25(27)28/h1-6,11H,7-10,12H2,(H,22,26)/p+1 |
| InChIKey | NMYDJAHZMZBAIS-UHFFFAOYSA-O |
| XLogP | 0.44 |
| TPSA | 132.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.45 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|