C19H31N4O5S+ — CID 8687831
N-[(2R)-heptan-2-yl]-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-ium-1-yl]acetamide (PubChem CID 8687831) has the molecular formula C19H31N4O5S+ and a molecular weight of 427.55 g/mol. Its IUPAC name is N-[(2R)-heptan-2-yl]-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-ium-1-yl]acetamide.
| Compound Name | N-[(2R)-heptan-2-yl]-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8687831 |
| Molecular Formula | C19H31N4O5S+ |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | N-[(2R)-heptan-2-yl]-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-ium-1-yl]acetamide |
| SMILES | CCCCC[C@@H](C)NC(=O)C[NH+]1CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H30N4O5S/c1-3-4-5-8-16(2)20-19(24)15-21-11-13-22(14-12-21)29(27,28)18-10-7-6-9-17(18)23(25)26/h6-7,9-10,16H,3-5,8,11-15H2,1-2H3,(H,20,24)/p+1/t16-/m1/s1 |
| InChIKey | RWWKTGMHBHPSDL-MRXNPFEDSA-O |
| XLogP | 0.57 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|