C17H25N4O3S+ — CID 9286849
N-[(2S)-butan-2-yl]-2-[4-(2-cyanophenyl)sulfonylpiperazin-1-ium-1-yl]acetamide (PubChem CID 9286849) has the molecular formula C17H25N4O3S+ and a molecular weight of 365.48 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-2-[4-(2-cyanophenyl)sulfonylpiperazin-1-ium-1-yl]acetamide.
| Compound Name | N-[(2S)-butan-2-yl]-2-[4-(2-cyanophenyl)sulfonylpiperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 9286849 |
| Molecular Formula | C17H25N4O3S+ |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | N-[(2S)-butan-2-yl]-2-[4-(2-cyanophenyl)sulfonylpiperazin-1-ium-1-yl]acetamide |
| SMILES | CC[C@H](C)NC(=O)C[NH+]1CCN(S(=O)(=O)c2ccccc2C#N)CC1 |
| InChI | InChI=1S/C17H24N4O3S/c1-3-14(2)19-17(22)13-20-8-10-21(11-9-20)25(23,24)16-7-5-4-6-15(16)12-18/h4-7,14H,3,8-11,13H2,1-2H3,(H,19,22)/p+1/t14-/m0/s1 |
| InChIKey | ZXRYLTZSYDESMC-AWEZNQCLSA-O |
| XLogP | -0.64 |
| TPSA | 94.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |