C18H21N4O4S+ — CID 9286763
2-[4-(2-cyanophenyl)sulfonylpiperazin-1-ium-1-yl]-N-(furan-2-ylmethyl)acetamide (PubChem CID 9286763) has the molecular formula C18H21N4O4S+ and a molecular weight of 389.46 g/mol. Its IUPAC name is 2-[4-(2-cyanophenyl)sulfonylpiperazin-1-ium-1-yl]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[4-(2-cyanophenyl)sulfonylpiperazin-1-ium-1-yl]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 9286763 |
| Molecular Formula | C18H21N4O4S+ |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 2-[4-(2-cyanophenyl)sulfonylpiperazin-1-ium-1-yl]-N-(furan-2-ylmethyl)acetamide |
| SMILES | N#Cc1ccccc1S(=O)(=O)N1CC[NH+](CC(=O)NCc2ccco2)CC1 |
| InChI | InChI=1S/C18H20N4O4S/c19-12-15-4-1-2-6-17(15)27(24,25)22-9-7-21(8-10-22)14-18(23)20-13-16-5-3-11-26-16/h1-6,11H,7-10,13-14H2,(H,20,23)/p+1 |
| InChIKey | KRUVUJUBDGUWNI-UHFFFAOYSA-O |
| XLogP | -0.64 |
| TPSA | 107.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |