C15H19FN3O3S+ — CID 8690303
2-[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-prop-2-ynylacetamide (PubChem CID 8690303) has the molecular formula C15H19FN3O3S+ and a molecular weight of 340.40 g/mol. Its IUPAC name is 2-[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-prop-2-ynylacetamide.
| Compound Name | 2-[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 8690303 |
| Molecular Formula | C15H19FN3O3S+ |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 2-[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)C[NH+]1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C15H18FN3O3S/c1-2-7-17-15(20)12-18-8-10-19(11-9-18)23(21,22)14-6-4-3-5-13(14)16/h1,3-6H,7-12H2,(H,17,20)/p+1 |
| InChIKey | DYACIGRXFCXWMJ-UHFFFAOYSA-O |
| XLogP | -1.54 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|