C18H27FN3O3S+ — CID 8749372
1-(azepan-1-yl)-2-[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]ethanone (PubChem CID 8749372) has the molecular formula C18H27FN3O3S+ and a molecular weight of 384.50 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]ethanone.
| Compound Name | 1-(azepan-1-yl)-2-[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 8749372 |
| Molecular Formula | C18H27FN3O3S+ |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 1-(azepan-1-yl)-2-[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]ethanone |
| SMILES | O=C(C[NH+]1CCN(S(=O)(=O)c2ccccc2F)CC1)N1CCCCCC1 |
| InChI | InChI=1S/C18H26FN3O3S/c19-16-7-3-4-8-17(16)26(24,25)22-13-11-20(12-14-22)15-18(23)21-9-5-1-2-6-10-21/h3-4,7-8H,1-2,5-6,9-15H2/p+1 |
| InChIKey | NDSLRCZVDDAJJA-UHFFFAOYSA-O |
| XLogP | 0.12 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |