C25H31FN2O4S — CID 110081621
2-[1-(2-fluorophenyl)sulfonyl-4-(phenoxymethyl)piperidin-4-yl]-1-piperidin-1-ylethanone (PubChem CID 110081621) has the molecular formula C25H31FN2O4S and a molecular weight of 474.60 g/mol. Its IUPAC name is 2-[1-(2-fluorophenyl)sulfonyl-4-(phenoxymethyl)piperidin-4-yl]-1-piperidin-1-ylethanone.
| Compound Name | 2-[1-(2-fluorophenyl)sulfonyl-4-(phenoxymethyl)piperidin-4-yl]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 110081621 |
| Molecular Formula | C25H31FN2O4S |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 2-[1-(2-fluorophenyl)sulfonyl-4-(phenoxymethyl)piperidin-4-yl]-1-piperidin-1-ylethanone |
| SMILES | O=C(CC1(COc2ccccc2)CCN(S(=O)(=O)c2ccccc2F)CC1)N1CCCCC1 |
| InChI | InChI=1S/C25H31FN2O4S/c26-22-11-5-6-12-23(22)33(30,31)28-17-13-25(14-18-28,20-32-21-9-3-1-4-10-21)19-24(29)27-15-7-2-8-16-27/h1,3-6,9-12H,2,7-8,13-20H2 |
| InChIKey | QPYMEDQETATHLO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |