C21H31FN3O3S+ — CID 11931839
2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-1-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]ethanone (PubChem CID 11931839) has the molecular formula C21H31FN3O3S+ and a molecular weight of 424.56 g/mol. Its IUPAC name is 2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-1-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]ethanone.
| Compound Name | 2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-1-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 11931839 |
| Molecular Formula | C21H31FN3O3S+ |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-1-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]ethanone |
| SMILES | O=C(C[NH+]1CC[C@H]2CCCC[C@@H]2C1)N1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C21H30FN3O3S/c22-19-7-3-4-8-20(19)29(27,28)25-13-11-24(12-14-25)21(26)16-23-10-9-17-5-1-2-6-18(17)15-23/h3-4,7-8,17-18H,1-2,5-6,9-16H2/p+1/t17-,18-/m1/s1 |
| InChIKey | DWNQBKZSMZTUAF-QZTJIDSGSA-O |
| XLogP | 0.75 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |