C21H30FN3O3S — CID 8690224
1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]ethanone (PubChem CID 8690224) has the molecular formula C21H30FN3O3S and a molecular weight of 423.55 g/mol. Its IUPAC name is 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]ethanone.
| Compound Name | 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 8690224 |
| Molecular Formula | C21H30FN3O3S |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]ethanone |
| SMILES | O=C(CN1CCN(S(=O)(=O)c2ccccc2F)CC1)N1CC[C@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C21H30FN3O3S/c22-19-7-3-4-8-20(19)29(27,28)25-13-11-23(12-14-25)16-21(26)24-10-9-17-5-1-2-6-18(17)15-24/h3-4,7-8,17-18H,1-2,5-6,9-16H2/t17-,18+/m1/s1 |
| InChIKey | RXMKNUWNECMEAV-MSOLQXFVSA-N |
| XLogP | 2.17 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |