C15H21FN2O2S — CID 45369149
1-cyclopentyl-4-(2-fluorophenyl)sulfonylpiperazine (PubChem CID 45369149) has the molecular formula C15H21FN2O2S and a molecular weight of 312.41 g/mol. Its IUPAC name is 1-cyclopentyl-4-(2-fluorophenyl)sulfonylpiperazine.
| Compound Name | 1-cyclopentyl-4-(2-fluorophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 45369149 |
| Molecular Formula | C15H21FN2O2S |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1-cyclopentyl-4-(2-fluorophenyl)sulfonylpiperazine |
| SMILES | O=S(=O)(c1ccccc1F)N1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C15H21FN2O2S/c16-14-7-3-4-8-15(14)21(19,20)18-11-9-17(10-12-18)13-5-1-2-6-13/h3-4,7-8,13H,1-2,5-6,9-12H2 |
| InChIKey | GBEZTIUQTPDERE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |