C14H18FNO2S — CID 78989322
1-(2-fluorophenyl)sulfonyl-2,3,3a,4,5,6,7,7a-octahydroindole (PubChem CID 78989322) has the molecular formula C14H18FNO2S and a molecular weight of 283.37 g/mol. Its IUPAC name is 1-(2-fluorophenyl)sulfonyl-2,3,3a,4,5,6,7,7a-octahydroindole.
| Compound Name | 1-(2-fluorophenyl)sulfonyl-2,3,3a,4,5,6,7,7a-octahydroindole |
|---|---|
| PubChem CID | 78989322 |
| Molecular Formula | C14H18FNO2S |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 1-(2-fluorophenyl)sulfonyl-2,3,3a,4,5,6,7,7a-octahydroindole |
| SMILES | O=S(=O)(c1ccccc1F)N1CCC2CCCCC21 |
| InChI | InChI=1S/C14H18FNO2S/c15-12-6-2-4-8-14(12)19(17,18)16-10-9-11-5-1-3-7-13(11)16/h2,4,6,8,11,13H,1,3,5,7,9-10H2 |
| InChIKey | XHJSRMRWFONPDJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |