C14H18F2N2O2S — CID 82751721
4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylsulfonyl)-3,5-difluoroaniline (PubChem CID 82751721) has the molecular formula C14H18F2N2O2S and a molecular weight of 316.37 g/mol. Its IUPAC name is 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylsulfonyl)-3,5-difluoroaniline.
| Compound Name | 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylsulfonyl)-3,5-difluoroaniline |
|---|---|
| PubChem CID | 82751721 |
| Molecular Formula | C14H18F2N2O2S |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylsulfonyl)-3,5-difluoroaniline |
| SMILES | Nc1cc(F)c(S(=O)(=O)N2CCC3CCCCC32)c(F)c1 |
| InChI | InChI=1S/C14H18F2N2O2S/c15-11-7-10(17)8-12(16)14(11)21(19,20)18-6-5-9-3-1-2-4-13(9)18/h7-9,13H,1-6,17H2 |
| InChIKey | ABUUVNSJTGPHKC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|