C15H22N2O2S — CID 82747391
2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylsulfonyl)-5-methylaniline (PubChem CID 82747391) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylsulfonyl)-5-methylaniline.
| Compound Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylsulfonyl)-5-methylaniline |
|---|---|
| PubChem CID | 82747391 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylsulfonyl)-5-methylaniline |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC3CCCCC32)c(N)c1 |
| InChI | InChI=1S/C15H22N2O2S/c1-11-6-7-15(13(16)10-11)20(18,19)17-9-8-12-4-2-3-5-14(12)17/h6-7,10,12,14H,2-5,8-9,16H2,1H3 |
| InChIKey | OOQLITQOTVMTBX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|