C15H20BrNO2S — CID 78989321
1-(2-bromo-4-methylphenyl)sulfonyl-2,3,3a,4,5,6,7,7a-octahydroindole (PubChem CID 78989321) has the molecular formula C15H20BrNO2S and a molecular weight of 358.30 g/mol. Its IUPAC name is 1-(2-bromo-4-methylphenyl)sulfonyl-2,3,3a,4,5,6,7,7a-octahydroindole.
| Compound Name | 1-(2-bromo-4-methylphenyl)sulfonyl-2,3,3a,4,5,6,7,7a-octahydroindole |
|---|---|
| PubChem CID | 78989321 |
| Molecular Formula | C15H20BrNO2S |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 1-(2-bromo-4-methylphenyl)sulfonyl-2,3,3a,4,5,6,7,7a-octahydroindole |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC3CCCCC32)c(Br)c1 |
| InChI | InChI=1S/C15H20BrNO2S/c1-11-6-7-15(13(16)10-11)20(18,19)17-9-8-12-4-2-3-5-14(12)17/h6-7,10,12,14H,2-5,8-9H2,1H3 |
| InChIKey | AGBFSJBVADWQIW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |