C16H22BrNO2S — CID 60660873
1-(5-bromo-2-methylphenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 60660873) has the molecular formula C16H22BrNO2S and a molecular weight of 372.33 g/mol. Its IUPAC name is 1-(5-bromo-2-methylphenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | 1-(5-bromo-2-methylphenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 60660873 |
| Molecular Formula | C16H22BrNO2S |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 1-(5-bromo-2-methylphenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | Cc1ccc(Br)cc1S(=O)(=O)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C16H22BrNO2S/c1-12-8-9-14(17)11-16(12)21(19,20)18-10-4-6-13-5-2-3-7-15(13)18/h8-9,11,13,15H,2-7,10H2,1H3 |
| InChIKey | QMCGOWZZIHVCNY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |