C15H19BrFNO2S — CID 116528534
1-(4-bromo-2-fluorophenyl)sulfonyl-2-cyclopentylpyrrolidine (PubChem CID 116528534) has the molecular formula C15H19BrFNO2S and a molecular weight of 376.29 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)sulfonyl-2-cyclopentylpyrrolidine.
| Compound Name | 1-(4-bromo-2-fluorophenyl)sulfonyl-2-cyclopentylpyrrolidine |
|---|---|
| PubChem CID | 116528534 |
| Molecular Formula | C15H19BrFNO2S |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)sulfonyl-2-cyclopentylpyrrolidine |
| SMILES | O=S(=O)(c1ccc(Br)cc1F)N1CCCC1C1CCCC1 |
| InChI | InChI=1S/C15H19BrFNO2S/c16-12-7-8-15(13(17)10-12)21(19,20)18-9-3-6-14(18)11-4-1-2-5-11/h7-8,10-11,14H,1-6,9H2 |
| InChIKey | OSVXDEUDGNKXRK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |