C12H12BrF4NO2S — CID 116528215
1-(4-bromo-2-fluorophenyl)sulfonyl-3-(trifluoromethyl)piperidine (PubChem CID 116528215) has the molecular formula C12H12BrF4NO2S and a molecular weight of 390.20 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)sulfonyl-3-(trifluoromethyl)piperidine.
| Compound Name | 1-(4-bromo-2-fluorophenyl)sulfonyl-3-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 116528215 |
| Molecular Formula | C12H12BrF4NO2S |
| Molecular Weight | 390.20 g/mol |
| Exact Mass | 388.97 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)sulfonyl-3-(trifluoromethyl)piperidine |
| SMILES | O=S(=O)(c1ccc(Br)cc1F)N1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H12BrF4NO2S/c13-9-3-4-11(10(14)6-9)21(19,20)18-5-1-2-8(7-18)12(15,16)17/h3-4,6,8H,1-2,5,7H2 |
| InChIKey | VPQWAHKNJZSJNY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.20 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |