C17H24F3NO2S — CID 70913404
1-(2-tert-butyl-4-methylphenyl)sulfonyl-3-(trifluoromethyl)piperidine (PubChem CID 70913404) has the molecular formula C17H24F3NO2S and a molecular weight of 363.45 g/mol. Its IUPAC name is 1-(2-tert-butyl-4-methylphenyl)sulfonyl-3-(trifluoromethyl)piperidine.
| Compound Name | 1-(2-tert-butyl-4-methylphenyl)sulfonyl-3-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 70913404 |
| Molecular Formula | C17H24F3NO2S |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 1-(2-tert-butyl-4-methylphenyl)sulfonyl-3-(trifluoromethyl)piperidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC(C(F)(F)F)C2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H24F3NO2S/c1-12-7-8-15(14(10-12)16(2,3)4)24(22,23)21-9-5-6-13(11-21)17(18,19)20/h7-8,10,13H,5-6,9,11H2,1-4H3 |
| InChIKey | CLCYJFQUTPVOQR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |