C10H15F3N4O2S — CID 61125152
1-methyl-4-[3-(trifluoromethyl)piperidin-1-yl]sulfonylpyrazol-3-amine (PubChem CID 61125152) has the molecular formula C10H15F3N4O2S and a molecular weight of 312.32 g/mol. Its IUPAC name is 1-methyl-4-[3-(trifluoromethyl)piperidin-1-yl]sulfonylpyrazol-3-amine.
| Compound Name | 1-methyl-4-[3-(trifluoromethyl)piperidin-1-yl]sulfonylpyrazol-3-amine |
|---|---|
| PubChem CID | 61125152 |
| Molecular Formula | C10H15F3N4O2S |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 1-methyl-4-[3-(trifluoromethyl)piperidin-1-yl]sulfonylpyrazol-3-amine |
| SMILES | Cn1cc(S(=O)(=O)N2CCCC(C(F)(F)F)C2)c(N)n1 |
| InChI | InChI=1S/C10H15F3N4O2S/c1-16-6-8(9(14)15-16)20(18,19)17-4-2-3-7(5-17)10(11,12)13/h6-7H,2-5H2,1H3,(H2,14,15) |
| InChIKey | UWYXQICFKBCMSA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |