C10H18N4O3S — CID 60814514
4-(2,6-dimethylmorpholin-4-yl)sulfonyl-1-methylpyrazol-3-amine (PubChem CID 60814514) has the molecular formula C10H18N4O3S and a molecular weight of 274.35 g/mol. Its IUPAC name is 4-(2,6-dimethylmorpholin-4-yl)sulfonyl-1-methylpyrazol-3-amine.
| Compound Name | 4-(2,6-dimethylmorpholin-4-yl)sulfonyl-1-methylpyrazol-3-amine |
|---|---|
| PubChem CID | 60814514 |
| Molecular Formula | C10H18N4O3S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 4-(2,6-dimethylmorpholin-4-yl)sulfonyl-1-methylpyrazol-3-amine |
| SMILES | CC1CN(S(=O)(=O)c2cn(C)nc2N)CC(C)O1 |
| InChI | InChI=1S/C10H18N4O3S/c1-7-4-14(5-8(2)17-7)18(15,16)9-6-13(3)12-10(9)11/h6-8H,4-5H2,1-3H3,(H2,11,12) |
| InChIKey | KQCSAOFBJKTBDI-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |