C16H17F3N2O2S — CID 36506249
3-methyl-8-[(3S)-3-(trifluoromethyl)piperidin-1-yl]sulfonylquinoline (PubChem CID 36506249) has the molecular formula C16H17F3N2O2S and a molecular weight of 358.39 g/mol. Its IUPAC name is 3-methyl-8-[(3S)-3-(trifluoromethyl)piperidin-1-yl]sulfonylquinoline.
| Compound Name | 3-methyl-8-[(3S)-3-(trifluoromethyl)piperidin-1-yl]sulfonylquinoline |
|---|---|
| PubChem CID | 36506249 |
| Molecular Formula | C16H17F3N2O2S |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 3-methyl-8-[(3S)-3-(trifluoromethyl)piperidin-1-yl]sulfonylquinoline |
| SMILES | Cc1cnc2c(S(=O)(=O)N3CCC[C@H](C(F)(F)F)C3)cccc2c1 |
| InChI | InChI=1S/C16H17F3N2O2S/c1-11-8-12-4-2-6-14(15(12)20-9-11)24(22,23)21-7-3-5-13(10-21)16(17,18)19/h2,4,6,8-9,13H,3,5,7,10H2,1H3/t13-/m0/s1 |
| InChIKey | DJJLVRALBZHHQZ-ZDUSSCGKSA-N |
| XLogP | 3.51 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |