C22H21N3O2S2 — CID 42939516
2-[1-(3-methylquinolin-8-yl)sulfonylpiperidin-3-yl]-1,3-benzothiazole (PubChem CID 42939516) has the molecular formula C22H21N3O2S2 and a molecular weight of 423.56 g/mol. Its IUPAC name is 2-[1-(3-methylquinolin-8-yl)sulfonylpiperidin-3-yl]-1,3-benzothiazole.
| Compound Name | 2-[1-(3-methylquinolin-8-yl)sulfonylpiperidin-3-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 42939516 |
| Molecular Formula | C22H21N3O2S2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 2-[1-(3-methylquinolin-8-yl)sulfonylpiperidin-3-yl]-1,3-benzothiazole |
| SMILES | Cc1cnc2c(S(=O)(=O)N3CCCC(c4nc5ccccc5s4)C3)cccc2c1 |
| InChI | InChI=1S/C22H21N3O2S2/c1-15-12-16-6-4-10-20(21(16)23-13-15)29(26,27)25-11-5-7-17(14-25)22-24-18-8-2-3-9-19(18)28-22/h2-4,6,8-10,12-13,17H,5,7,11,14H2,1H3 |
| InChIKey | CWUZAROFWGOVQK-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |