C18H17FN2O2S2 — CID 17496411
2-[1-(3-fluorophenyl)sulfonylpiperidin-3-yl]-1,3-benzothiazole (PubChem CID 17496411) has the molecular formula C18H17FN2O2S2 and a molecular weight of 376.48 g/mol. Its IUPAC name is 2-[1-(3-fluorophenyl)sulfonylpiperidin-3-yl]-1,3-benzothiazole.
| Compound Name | 2-[1-(3-fluorophenyl)sulfonylpiperidin-3-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 17496411 |
| Molecular Formula | C18H17FN2O2S2 |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 2-[1-(3-fluorophenyl)sulfonylpiperidin-3-yl]-1,3-benzothiazole |
| SMILES | O=S(=O)(c1cccc(F)c1)N1CCCC(c2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C18H17FN2O2S2/c19-14-6-3-7-15(11-14)25(22,23)21-10-4-5-13(12-21)18-20-16-8-1-2-9-17(16)24-18/h1-3,6-9,11,13H,4-5,10,12H2 |
| InChIKey | DGBNLFKXDJAHIP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |