C18H16F2N2O2S2 — CID 55456465
2-[1-(3,5-difluorophenyl)sulfonylpiperidin-4-yl]-1,3-benzothiazole (PubChem CID 55456465) has the molecular formula C18H16F2N2O2S2 and a molecular weight of 394.47 g/mol. Its IUPAC name is 2-[1-(3,5-difluorophenyl)sulfonylpiperidin-4-yl]-1,3-benzothiazole.
| Compound Name | 2-[1-(3,5-difluorophenyl)sulfonylpiperidin-4-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 55456465 |
| Molecular Formula | C18H16F2N2O2S2 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 2-[1-(3,5-difluorophenyl)sulfonylpiperidin-4-yl]-1,3-benzothiazole |
| SMILES | O=S(=O)(c1cc(F)cc(F)c1)N1CCC(c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C18H16F2N2O2S2/c19-13-9-14(20)11-15(10-13)26(23,24)22-7-5-12(6-8-22)18-21-16-3-1-2-4-17(16)25-18/h1-4,9-12H,5-8H2 |
| InChIKey | LMSJIIDFOGZCOD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |