C18H17N3O4S2 — CID 3223487
2-[1-(3-nitrophenyl)sulfonylpiperidin-4-yl]-1,3-benzothiazole (PubChem CID 3223487) has the molecular formula C18H17N3O4S2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 2-[1-(3-nitrophenyl)sulfonylpiperidin-4-yl]-1,3-benzothiazole.
| Compound Name | 2-[1-(3-nitrophenyl)sulfonylpiperidin-4-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 3223487 |
| Molecular Formula | C18H17N3O4S2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 2-[1-(3-nitrophenyl)sulfonylpiperidin-4-yl]-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)N2CCC(c3nc4ccccc4s3)CC2)c1 |
| InChI | InChI=1S/C18H17N3O4S2/c22-21(23)14-4-3-5-15(12-14)27(24,25)20-10-8-13(9-11-20)18-19-16-6-1-2-7-17(16)26-18/h1-7,12-13H,8-11H2 |
| InChIKey | URAMYJDYYHYJJG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 93.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|