C18H17ClN2O2S2 — CID 1430712
2-[1-(3-chlorophenyl)sulfonylpiperidin-4-yl]-1,3-benzothiazole (PubChem CID 1430712) has the molecular formula C18H17ClN2O2S2 and a molecular weight of 392.93 g/mol. Its IUPAC name is 2-[1-(3-chlorophenyl)sulfonylpiperidin-4-yl]-1,3-benzothiazole.
| Compound Name | 2-[1-(3-chlorophenyl)sulfonylpiperidin-4-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 1430712 |
| Molecular Formula | C18H17ClN2O2S2 |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 2-[1-(3-chlorophenyl)sulfonylpiperidin-4-yl]-1,3-benzothiazole |
| SMILES | O=S(=O)(c1cccc(Cl)c1)N1CCC(c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C18H17ClN2O2S2/c19-14-4-3-5-15(12-14)25(22,23)21-10-8-13(9-11-21)18-20-16-6-1-2-7-17(16)24-18/h1-7,12-13H,8-11H2 |
| InChIKey | LISAZRFTTDNSSC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |