C18H18ClN3O2S — CID 16582836
2-[1-(3-chlorophenyl)sulfonylpiperidin-4-yl]-1H-benzimidazole (PubChem CID 16582836) has the molecular formula C18H18ClN3O2S and a molecular weight of 375.88 g/mol. Its IUPAC name is 2-[1-(3-chlorophenyl)sulfonylpiperidin-4-yl]-1H-benzimidazole.
| Compound Name | 2-[1-(3-chlorophenyl)sulfonylpiperidin-4-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 16582836 |
| Molecular Formula | C18H18ClN3O2S |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 2-[1-(3-chlorophenyl)sulfonylpiperidin-4-yl]-1H-benzimidazole |
| SMILES | O=S(=O)(c1cccc(Cl)c1)N1CCC(c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C18H18ClN3O2S/c19-14-4-3-5-15(12-14)25(23,24)22-10-8-13(9-11-22)18-20-16-6-1-2-7-17(16)21-18/h1-7,12-13H,8-11H2,(H,20,21) |
| InChIKey | OYPQGHQQRNXIQR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |