C19H18F3N3O2S — CID 16582835
2-[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-1H-benzimidazole (PubChem CID 16582835) has the molecular formula C19H18F3N3O2S and a molecular weight of 409.43 g/mol. Its IUPAC name is 2-[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-1H-benzimidazole.
| Compound Name | 2-[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 16582835 |
| Molecular Formula | C19H18F3N3O2S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 2-[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-1H-benzimidazole |
| SMILES | O=S(=O)(c1cccc(C(F)(F)F)c1)N1CCC(c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C19H18F3N3O2S/c20-19(21,22)14-4-3-5-15(12-14)28(26,27)25-10-8-13(9-11-25)18-23-16-6-1-2-7-17(16)24-18/h1-7,12-13H,8-11H2,(H,23,24) |
| InChIKey | PYMCILPFNOYFET-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |