About 2-[1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperidin-4-yl]-1H-benzimidazole
2-[1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperidin-4-yl]-1H-benzimidazole (PubChem CID 112807240) has the molecular formula C18H16BrCl2N3O2S
and a molecular weight of 489.22 g/mol. Its IUPAC name is 2-[1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperidin-4-yl]-1H-benzimidazole.
Molecular Properties
| Compound Name | 2-[1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperidin-4-yl]-1H-benzimidazole |
| PubChem CID | 112807240 |
| Molecular Formula | C18H16BrCl2N3O2S |
| Molecular Weight | 489.22 g/mol |
| Exact Mass | 486.95 |
| IUPAC Name | 2-[1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperidin-4-yl]-1H-benzimidazole |
| SMILES | O=S(=O)(c1c(Cl)cc(Br)cc1Cl)N1CCC(c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C18H16BrCl2N3O2S/c19-12-9-13(20)17(14(21)10-12)27(25,26)24-7-5-11(6-8-24)18-22-15-3-1-2-4-16(15)23-18/h1-4,9-11H,5-8H2,(H,22,23) |
| InChIKey | LREUDEVGSWBGLR-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.22 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperidin-4-yl]-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperidin-4-yl]-1H-benzimidazole?
The IUPAC name of 2-[1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperidin-4-yl]-1H-benzimidazole (CID 112807240) is 2-[1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperidin-4-yl]-1H-benzimidazole.
What is the SMILES notation for 2-[1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperidin-4-yl]-1H-benzimidazole?
The canonical SMILES for 2-[1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperidin-4-yl]-1H-benzimidazole is O=S(=O)(c1c(Cl)cc(Br)cc1Cl)N1CCC(c2nc3ccccc3[nH]2)CC1.
What is the InChIKey of 2-[1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperidin-4-yl]-1H-benzimidazole?
The InChIKey is LREUDEVGSWBGLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16BrCl2N3O2S/c19-12-9-13(20)17(14(21)10-12)27(25,26)24-7-5-11(6-8-24)18-22-15-3-1-2-4-16(15)23-18/h1-4,9-11H,5-8H2,(H,22,23).
What are the key properties of 2-[1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperidin-4-yl]-1H-benzimidazole?
2-[1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperidin-4-yl]-1H-benzimidazole has a molecular weight of 489.22 g/mol, XLogP of 5.20, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperidin-4-yl]-1H-benzimidazole is sourced from PubChem (CID 112807240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).