C17H21N5O2S — CID 131934260
2-[1-[(2-ethyl-1H-imidazol-5-yl)sulfonyl]piperidin-4-yl]-1H-benzimidazole (PubChem CID 131934260) has the molecular formula C17H21N5O2S and a molecular weight of 359.46 g/mol. Its IUPAC name is 2-[1-[(2-ethyl-1H-imidazol-5-yl)sulfonyl]piperidin-4-yl]-1H-benzimidazole.
| Compound Name | 2-[1-[(2-ethyl-1H-imidazol-5-yl)sulfonyl]piperidin-4-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 131934260 |
| Molecular Formula | C17H21N5O2S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2-[1-[(2-ethyl-1H-imidazol-5-yl)sulfonyl]piperidin-4-yl]-1H-benzimidazole |
| SMILES | CCc1ncc(S(=O)(=O)N2CCC(c3nc4ccccc4[nH]3)CC2)[nH]1 |
| InChI | InChI=1S/C17H21N5O2S/c1-2-15-18-11-16(21-15)25(23,24)22-9-7-12(8-10-22)17-19-13-5-3-4-6-14(13)20-17/h3-6,11-12H,2,7-10H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | VBLFLWWLCFJTNI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |